C18H11BrF6N4O4 — CID 159694820
1-bromo-3-nitro-5-(trifluoromethyl)benzene;4-methyl-1-[3-nitro-5-(trifluoromethyl)phenyl]imidazole (PubChem CID 159694820) has the molecular formula C18H11BrF6N4O4 and a molecular weight of 541.20 g/mol. Its IUPAC name is 1-bromo-3-nitro-5-(trifluoromethyl)benzene;4-methyl-1-[3-nitro-5-(trifluoromethyl)phenyl]imidazole.
| Compound Name | 1-bromo-3-nitro-5-(trifluoromethyl)benzene;4-methyl-1-[3-nitro-5-(trifluoromethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 159694820 |
| Molecular Formula | C18H11BrF6N4O4 |
| Molecular Weight | 541.20 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | 1-bromo-3-nitro-5-(trifluoromethyl)benzene;4-methyl-1-[3-nitro-5-(trifluoromethyl)phenyl]imidazole |
| SMILES | Cc1cn(-c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)cn1.O=[N+]([O-])c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F3N3O2.C7H3BrF3NO2/c1-7-5-16(6-15-7)9-2-8(11(12,13)14)3-10(4-9)17(18)19;8-5-1-4(7(9,10)11)2-6(3-5)12(13)14/h2-6H,1H3;1-3H |
| InChIKey | MWWIVPMXECLLTJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.20 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|