About acetamide;pyrrole-2,5-dione
acetamide;pyrrole-2,5-dione (PubChem CID 159695137) has the molecular formula C8H13N3O4
and a molecular weight of 215.21 g/mol. Its IUPAC name is acetamide;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | acetamide;pyrrole-2,5-dione |
| PubChem CID | 159695137 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | acetamide;pyrrole-2,5-dione |
| SMILES | CC(N)=O.CC(N)=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.2C2H5NO/c6-3-1-2-4(7)5-3;2*1-2(3)4/h1-2H,(H,5,6,7);2*1H3,(H2,3,4) |
| InChIKey | MWXIKCXZJYGFGN-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze acetamide;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;pyrrole-2,5-dione?
The IUPAC name of acetamide;pyrrole-2,5-dione (CID 159695137) is acetamide;pyrrole-2,5-dione.
What is the SMILES notation for acetamide;pyrrole-2,5-dione?
The canonical SMILES for acetamide;pyrrole-2,5-dione is CC(N)=O.CC(N)=O.O=C1C=CC(=O)N1.
What is the InChIKey of acetamide;pyrrole-2,5-dione?
The InChIKey is MWXIKCXZJYGFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.2C2H5NO/c6-3-1-2-4(7)5-3;2*1-2(3)4/h1-2H,(H,5,6,7);2*1H3,(H2,3,4).
What are the key properties of acetamide;pyrrole-2,5-dione?
acetamide;pyrrole-2,5-dione has a molecular weight of 215.21 g/mol, XLogP of -1.82, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;pyrrole-2,5-dione is sourced from PubChem (CID 159695137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).