About 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene
5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene (PubChem CID 159695290) has the molecular formula C12H17N3O6S
and a molecular weight of 331.35 g/mol. Its IUPAC name is 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene.
Molecular Properties
| Compound Name | 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene |
| PubChem CID | 159695290 |
| Molecular Formula | C12H17N3O6S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene |
| SMILES | CC(C)(C)OC(=O)C(=O)c1ccc(N)cc1S(=O)(=O)O.[H]/N=N/[H] |
| InChI | InChI=1S/C12H15NO6S.H2N2/c1-12(2,3)19-11(15)10(14)8-5-4-7(13)6-9(8)20(16,17)18;1-2/h4-6H,13H2,1-3H3,(H,16,17,18);1-2H/b;2-1+ |
| InChIKey | MWXVGQZYYRXFEM-WLHGVMLRSA-N |
| XLogP | 1.64 |
| TPSA | 171.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene?
The IUPAC name of 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene (CID 159695290) is 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene.
What is the SMILES notation for 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene?
The canonical SMILES for 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene is CC(C)(C)OC(=O)C(=O)c1ccc(N)cc1S(=O)(=O)O.[H]/N=N/[H].
What is the InChIKey of 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene?
The InChIKey is MWXVGQZYYRXFEM-WLHGVMLRSA-N. The full InChI is InChI=1S/C12H15NO6S.H2N2/c1-12(2,3)19-11(15)10(14)8-5-4-7(13)6-9(8)20(16,17)18;1-2/h4-6H,13H2,1-3H3,(H,16,17,18);1-2H/b;2-1+.
What are the key properties of 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene?
5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene has a molecular weight of 331.35 g/mol, XLogP of 1.64, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]benzenesulfonic acid;diazene is sourced from PubChem (CID 159695290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).