About 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole
3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole (PubChem CID 159696966) has the molecular formula C9H10N6O
and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole.
Molecular Properties
| Compound Name | 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole |
| PubChem CID | 159696966 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole |
| SMILES | Cc1nn[nH]n1.Cc1noc2ncccc12 |
| InChI | InChI=1S/C7H6N2O.C2H4N4/c1-5-6-3-2-4-8-7(6)10-9-5;1-2-3-5-6-4-2/h2-4H,1H3;1H3,(H,3,4,5,6) |
| InChIKey | MXDBRCMECDZLTI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole?
The IUPAC name of 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole (CID 159696966) is 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole.
What is the SMILES notation for 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole?
The canonical SMILES for 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole is Cc1nn[nH]n1.Cc1noc2ncccc12.
What is the InChIKey of 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole?
The InChIKey is MXDBRCMECDZLTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O.C2H4N4/c1-5-6-3-2-4-8-7(6)10-9-5;1-2-3-5-6-4-2/h2-4H,1H3;1H3,(H,3,4,5,6).
What are the key properties of 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole?
3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole has a molecular weight of 218.22 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-[1,2]oxazolo[5,4-b]pyridine;5-methyl-2H-tetrazole is sourced from PubChem (CID 159696966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).