C9H16F3NO2 — CID 159697562
(3R,4S)-4-methoxy-3-methylpiperidine;2,2,2-trifluoroacetaldehyde (PubChem CID 159697562) has the molecular formula C9H16F3NO2 and a molecular weight of 227.23 g/mol. Its IUPAC name is (3R,4S)-4-methoxy-3-methylpiperidine;2,2,2-trifluoroacetaldehyde.
| Compound Name | (3R,4S)-4-methoxy-3-methylpiperidine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159697562 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (3R,4S)-4-methoxy-3-methylpiperidine;2,2,2-trifluoroacetaldehyde |
| SMILES | CO[C@H]1CCNC[C@H]1C.O=CC(F)(F)F |
| InChI | InChI=1S/C7H15NO.C2HF3O/c1-6-5-8-4-3-7(6)9-2;3-2(4,5)1-6/h6-8H,3-5H2,1-2H3;1H/t6-,7+;/m1./s1 |
| InChIKey | MXFAJFOYFDYDRK-HHQFNNIRSA-N |
| XLogP | 1.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|