About acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium
acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium (PubChem CID 159697893) has the molecular formula C22H27N2O4S+
and a molecular weight of 415.54 g/mol. Its IUPAC name is acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium.
Molecular Properties
| Compound Name | acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium |
| PubChem CID | 159697893 |
| Molecular Formula | C22H27N2O4S+ |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium |
| SMILES | CC(=O)O.O=S1(=O)CCC([NH2+]CCc2c(-c3ccccc3)[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C20H22N2O2S.C2H4O2/c23-25(24)13-11-16(14-25)21-12-10-18-17-8-4-5-9-19(17)22-20(18)15-6-2-1-3-7-15;1-2(3)4/h1-9,16,21-22H,10-14H2;1H3,(H,3,4)/p+1 |
| InChIKey | IYLKRHLJKXCJKI-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium?
The IUPAC name of acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium (CID 159697893) is acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium.
What is the SMILES notation for acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium?
The canonical SMILES for acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium is CC(=O)O.O=S1(=O)CCC([NH2+]CCc2c(-c3ccccc3)[nH]c3ccccc23)C1.
What is the InChIKey of acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium?
The InChIKey is IYLKRHLJKXCJKI-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H22N2O2S.C2H4O2/c23-25(24)13-11-16(14-25)21-12-10-18-17-8-4-5-9-19(17)22-20(18)15-6-2-1-3-7-15;1-2(3)4/h1-9,16,21-22H,10-14H2;1H3,(H,3,4)/p+1.
What are the key properties of acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium?
acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium has a molecular weight of 415.54 g/mol, XLogP of 2.22, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(1,1-dioxothiolan-3-yl)-[2-(2-phenyl-1H-indol-3-yl)ethyl]azanium is sourced from PubChem (CID 159697893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).