C22H37N3 — CID 159698981
1-tert-butyl-4-[(2-propan-2-yl-4-pyrrolidin-1-ylphenyl)methyl]piperazine (PubChem CID 159698981) has the molecular formula C22H37N3 and a molecular weight of 343.56 g/mol. Its IUPAC name is 1-tert-butyl-4-[(2-propan-2-yl-4-pyrrolidin-1-ylphenyl)methyl]piperazine.
| Compound Name | 1-tert-butyl-4-[(2-propan-2-yl-4-pyrrolidin-1-ylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 159698981 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | 1-tert-butyl-4-[(2-propan-2-yl-4-pyrrolidin-1-ylphenyl)methyl]piperazine |
| SMILES | CC(C)c1cc(N2CCCC2)ccc1CN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H37N3/c1-18(2)21-16-20(24-10-6-7-11-24)9-8-19(21)17-23-12-14-25(15-13-23)22(3,4)5/h8-9,16,18H,6-7,10-15,17H2,1-5H3 |
| InChIKey | MXJMBENCWLCBKI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|