About lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide
lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide (PubChem CID 15969921) has the molecular formula C12H17LiN2O2
and a molecular weight of 228.22 g/mol. Its IUPAC name is lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide.
Molecular Properties
| Compound Name | lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide |
| PubChem CID | 15969921 |
| Molecular Formula | C12H17LiN2O2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide |
| SMILES | CC(C)N(C(=O)c1cc[c-]c[n+]1[O-])C(C)C.[Li+] |
| InChI | InChI=1S/C12H17N2O2.Li/c1-9(2)14(10(3)4)12(15)11-7-5-6-8-13(11)16;/h5,7-10H,1-4H3;/q-1;+1 |
| InChIKey | GMOGTYPTWJTKGG-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide?
The IUPAC name of lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide (CID 15969921) is lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide.
What is the SMILES notation for lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide?
The canonical SMILES for lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide is CC(C)N(C(=O)c1cc[c-]c[n+]1[O-])C(C)C.[Li+].
What is the InChIKey of lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide?
The InChIKey is GMOGTYPTWJTKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N2O2.Li/c1-9(2)14(10(3)4)12(15)11-7-5-6-8-13(11)16;/h5,7-10H,1-4H3;/q-1;+1.
What are the key properties of lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide?
lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide has a molecular weight of 228.22 g/mol, XLogP of -1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide is sourced from PubChem (CID 15969921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).