C19H15Cl — CID 159699272
7-chloro-11,11-dimethylbenzo[a]fluorene (PubChem CID 159699272) has the molecular formula C19H15Cl and a molecular weight of 278.78 g/mol. Its IUPAC name is 7-chloro-11,11-dimethylbenzo[a]fluorene.
| Compound Name | 7-chloro-11,11-dimethylbenzo[a]fluorene |
|---|---|
| PubChem CID | 159699272 |
| Molecular Formula | C19H15Cl |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 7-chloro-11,11-dimethylbenzo[a]fluorene |
| SMILES | CC1(C)c2cccc(Cl)c2-c2ccc3ccccc3c21 |
| InChI | InChI=1S/C19H15Cl/c1-19(2)15-8-5-9-16(20)17(15)14-11-10-12-6-3-4-7-13(12)18(14)19/h3-11H,1-2H3 |
| InChIKey | QUZSXCBKWFTGKD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |