C59H53F3N4O4S — CID 159700270
2-[3-[3-[3,5-bis(2-phenylpropan-2-yl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole;trifluoromethanesulfonate (PubChem CID 159700270) has the molecular formula C59H53F3N4O4S and a molecular weight of 971.16 g/mol. Its IUPAC name is 2-[3-[3-[3,5-bis(2-phenylpropan-2-yl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole;trifluoromethanesulfonate.
| Compound Name | 2-[3-[3-[3,5-bis(2-phenylpropan-2-yl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159700270 |
| Molecular Formula | C59H53F3N4O4S |
| Molecular Weight | 971.16 g/mol |
| Exact Mass | 970.37 |
| IUPAC Name | 2-[3-[3-[3,5-bis(2-phenylpropan-2-yl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole;trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5c[n+](-c6cc(C(C)(C)c7ccccc7)cc(C(C)(C)c7ccccc7)c6)c6ccccc65)c4)cc32)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C58H53N4O.CHF3O3S/c1-56(2,3)42-31-32-59-55(36-42)62-51-26-15-14-25-49(51)50-30-29-48(38-54(50)62)63-47-24-18-23-45(37-47)60-39-61(53-28-17-16-27-52(53)60)46-34-43(57(4,5)40-19-10-8-11-20-40)33-44(35-46)58(6,7)41-21-12-9-13-22-41;2-1(3,4)8(5,6)7/h8-39H,1-7H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | MXNMPIJAMYAIIY-UHFFFAOYSA-M |
| XLogP | 14.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.16 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|