C12H12O9 — CID 159700573
cyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 159700573) has the molecular formula C12H12O9 and a molecular weight of 300.22 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 159700573 |
| Molecular Formula | C12H12O9 |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H8O7.C6H4O2/c7-3(8)1-6(13,5(11)12)2-4(9)10;7-5-1-2-6(8)4-3-5/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-4H |
| InChIKey | MXOKLRFAECFONE-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|