C14H12O12 — CID 159701599
(E)-but-2-enedioic acid;but-2-ynedioic acid;2-prop-1-ynylpropanedioic acid (PubChem CID 159701599) has the molecular formula C14H12O12 and a molecular weight of 372.24 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;but-2-ynedioic acid;2-prop-1-ynylpropanedioic acid.
| Compound Name | (E)-but-2-enedioic acid;but-2-ynedioic acid;2-prop-1-ynylpropanedioic acid |
|---|---|
| PubChem CID | 159701599 |
| Molecular Formula | C14H12O12 |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (E)-but-2-enedioic acid;but-2-ynedioic acid;2-prop-1-ynylpropanedioic acid |
| SMILES | CC#CC(C(=O)O)C(=O)O.O=C(O)/C=C/C(=O)O.O=C(O)C#CC(=O)O |
| InChI | InChI=1S/C6H6O4.C4H4O4.C4H2O4/c1-2-3-4(5(7)8)6(9)10;2*5-3(6)1-2-4(7)8/h4H,1H3,(H,7,8)(H,9,10);1-2H,(H,5,6)(H,7,8);(H,5,6)(H,7,8)/b;2-1+; |
| InChIKey | IGICLLHDIOVPLV-JITBQSAISA-N |
| XLogP | -1.33 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|