About chloric acid;perchloric acid
chloric acid;perchloric acid (PubChem CID 159701924) has the molecular formula H3Cl3O10
and a molecular weight of 269.37 g/mol. Its IUPAC name is chloric acid;perchloric acid.
Molecular Properties
| Compound Name | chloric acid;perchloric acid |
| PubChem CID | 159701924 |
| Molecular Formula | H3Cl3O10 |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 267.88 |
| IUPAC Name | chloric acid;perchloric acid |
| SMILES | [O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/ClHO4.2ClHO3/c2-1(3,4)5;2*2-1(3)4/h(H,2,3,4,5);2*2H |
| InChIKey | WCDLJZQWGQIUFC-UHFFFAOYSA-N |
| XLogP | -9.99 |
| TPSA | 222.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | -9.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze chloric acid;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloric acid;perchloric acid?
The IUPAC name of chloric acid;perchloric acid (CID 159701924) is chloric acid;perchloric acid.
What is the SMILES notation for chloric acid;perchloric acid?
The canonical SMILES for chloric acid;perchloric acid is [O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of chloric acid;perchloric acid?
The InChIKey is WCDLJZQWGQIUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO4.2ClHO3/c2-1(3,4)5;2*2-1(3)4/h(H,2,3,4,5);2*2H.
What are the key properties of chloric acid;perchloric acid?
chloric acid;perchloric acid has a molecular weight of 269.37 g/mol, XLogP of -9.99, 0 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for chloric acid;perchloric acid is sourced from PubChem (CID 159701924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).