chloric acid;perchloric acid

H3Cl3O10 — CID 159701924

IUPACchloric acid;perchloric acid
SMILES[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/ClHO4.2ClHO3/c2-1(3,4)5;2*2-1(3)4/h(H,2,3,4,5);2*2H
InChIKeyWCDLJZQWGQIUFC-UHFFFAOYSA-N
MW269.37 g/mol
LogP-9.99
Rot. Bonds

About chloric acid;perchloric acid

chloric acid;perchloric acid (PubChem CID 159701924) has the molecular formula H3Cl3O10 and a molecular weight of 269.37 g/mol. Its IUPAC name is chloric acid;perchloric acid.

Molecular Properties

Compound Namechloric acid;perchloric acid
PubChem CID159701924
Molecular FormulaH3Cl3O10
Molecular Weight269.37 g/mol
Exact Mass267.88
IUPAC Namechloric acid;perchloric acid
SMILES[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/ClHO4.2ClHO3/c2-1(3,4)5;2*2-1(3)4/h(H,2,3,4,5);2*2H
InChIKeyWCDLJZQWGQIUFC-UHFFFAOYSA-N
XLogP-9.99
TPSA222.11 Ų
H-Bond Donors3
H-Bond Acceptors10
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.37
LogP ≤ 5-9.99
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 1010

Analyze chloric acid;perchloric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloric acid;perchloric acid?
The IUPAC name of chloric acid;perchloric acid (CID 159701924) is chloric acid;perchloric acid.
What is the SMILES notation for chloric acid;perchloric acid?
The canonical SMILES for chloric acid;perchloric acid is [O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of chloric acid;perchloric acid?
The InChIKey is WCDLJZQWGQIUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO4.2ClHO3/c2-1(3,4)5;2*2-1(3)4/h(H,2,3,4,5);2*2H.
What are the key properties of chloric acid;perchloric acid?
chloric acid;perchloric acid has a molecular weight of 269.37 g/mol, XLogP of -9.99, 0 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for chloric acid;perchloric acid is sourced from PubChem (CID 159701924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).