C21H22N4+2 — CID 159703702
13,13,14,14,18-pentamethyl-1,5-diaza-10,18-diazoniahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15(20),16,18-octaene (PubChem CID 159703702) has the molecular formula C21H22N4+2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 13,13,14,14,18-pentamethyl-1,5-diaza-10,18-diazoniahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15(20),16,18-octaene.
| Compound Name | 13,13,14,14,18-pentamethyl-1,5-diaza-10,18-diazoniahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15(20),16,18-octaene |
|---|---|
| PubChem CID | 159703702 |
| Molecular Formula | C21H22N4+2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 13,13,14,14,18-pentamethyl-1,5-diaza-10,18-diazoniahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15(20),16,18-octaene |
| SMILES | C[n+]1ccc2c3c1c1nccc4c1c1n3c(c[n+]1C4)C(C)(C)C2(C)C |
| InChI | InChI=1S/C21H22N4/c1-20(2)13-7-9-23(5)18-16-15-12(6-8-22-16)10-24-11-14(21(20,3)4)25(17(13)18)19(15)24/h6-9,11H,10H2,1-5H3/q+2 |
| InChIKey | SAJOANIBRXOAKI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|