C40H65N3O6 — CID 159703937
2-[2-[4-[3-[bis(5-butoxy-2-methylphenyl)methyl]piperidin-1-yl]butylamino]-2-oxoethoxy]acetate;tetramethylazanium (PubChem CID 159703937) has the molecular formula C40H65N3O6 and a molecular weight of 683.97 g/mol. Its IUPAC name is 2-[2-[4-[3-[bis(5-butoxy-2-methylphenyl)methyl]piperidin-1-yl]butylamino]-2-oxoethoxy]acetate;tetramethylazanium.
| Compound Name | 2-[2-[4-[3-[bis(5-butoxy-2-methylphenyl)methyl]piperidin-1-yl]butylamino]-2-oxoethoxy]acetate;tetramethylazanium |
|---|---|
| PubChem CID | 159703937 |
| Molecular Formula | C40H65N3O6 |
| Molecular Weight | 683.97 g/mol |
| Exact Mass | 683.49 |
| IUPAC Name | 2-[2-[4-[3-[bis(5-butoxy-2-methylphenyl)methyl]piperidin-1-yl]butylamino]-2-oxoethoxy]acetate;tetramethylazanium |
| SMILES | CCCCOc1ccc(C)c(C(c2cc(OCCCC)ccc2C)C2CCCN(CCCCNC(=O)COCC(=O)[O-])C2)c1.C[N+](C)(C)C |
| InChI | InChI=1S/C36H54N2O6.C4H12N/c1-5-7-20-43-30-15-13-27(3)32(22-30)36(33-23-31(16-14-28(33)4)44-21-8-6-2)29-12-11-19-38(24-29)18-10-9-17-37-34(39)25-42-26-35(40)41;1-5(2,3)4/h13-16,22-23,29,36H,5-12,17-21,24-26H2,1-4H3,(H,37,39)(H,40,41);1-4H3/q;+1/p-1 |
| InChIKey | MXYYMXLMICKQLW-UHFFFAOYSA-M |
| XLogP | 5.49 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.97 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|