About tert-butyl acetate
tert-butyl acetate (PubChem CID 159704758) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is tert-butyl acetate.
Molecular Properties
| Compound Name | tert-butyl acetate |
| PubChem CID | 159704758 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | tert-butyl acetate |
| SMILES | CC(=O)OC(C)(C)C.CC(=O)OC(C)(C)C |
| InChI | InChI=1S/2C6H12O2/c2*1-5(7)8-6(2,3)4/h2*1-4H3 |
| InChIKey | MYBLBYAKKANREI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate?
The IUPAC name of tert-butyl acetate (CID 159704758) is tert-butyl acetate.
What is the SMILES notation for tert-butyl acetate?
The canonical SMILES for tert-butyl acetate is CC(=O)OC(C)(C)C.CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl acetate?
The InChIKey is MYBLBYAKKANREI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12O2/c2*1-5(7)8-6(2,3)4/h2*1-4H3.
What are the key properties of tert-butyl acetate?
tert-butyl acetate has a molecular weight of 232.32 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate is sourced from PubChem (CID 159704758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).