About 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one
6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one (PubChem CID 159705144) has the molecular formula C23H18Br2ClN3O3
and a molecular weight of 579.68 g/mol. Its IUPAC name is 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one |
| PubChem CID | 159705144 |
| Molecular Formula | C23H18Br2ClN3O3 |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 576.94 |
| IUPAC Name | 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one |
| SMILES | Clc1ccc2cc(Br)ccc2n1.O=C1OCCN1CCOc1ccc2cc(Br)ccc2n1 |
| InChI | InChI=1S/C14H13BrN2O3.C9H5BrClN/c15-11-2-3-12-10(9-11)1-4-13(16-12)19-7-5-17-6-8-20-14(17)18;10-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-4,9H,5-8H2;1-5H |
| InChIKey | MYCPSVONWQNSDU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one?
The IUPAC name of 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one (CID 159705144) is 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one is Clc1ccc2cc(Br)ccc2n1.O=C1OCCN1CCOc1ccc2cc(Br)ccc2n1.
What is the InChIKey of 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one?
The InChIKey is MYCPSVONWQNSDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2O3.C9H5BrClN/c15-11-2-3-12-10(9-11)1-4-13(16-12)19-7-5-17-6-8-20-14(17)18;10-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-4,9H,5-8H2;1-5H.
What are the key properties of 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one?
6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one has a molecular weight of 579.68 g/mol, XLogP of 6.48, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-chloroquinoline;3-[2-(6-bromoquinolin-2-yl)oxyethyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 159705144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).