C13H10ClN3OS — CID 159705168
3-amino-5-(4-chloro-3-methylphenyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 159705168) has the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. Its IUPAC name is 3-amino-5-(4-chloro-3-methylphenyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-amino-5-(4-chloro-3-methylphenyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 159705168 |
| Molecular Formula | C13H10ClN3OS |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 3-amino-5-(4-chloro-3-methylphenyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(-c2csc3ncn(N)c(=O)c23)ccc1Cl |
| InChI | InChI=1S/C13H10ClN3OS/c1-7-4-8(2-3-10(7)14)9-5-19-12-11(9)13(18)17(15)6-16-12/h2-6H,15H2,1H3 |
| InChIKey | IPESJINSHATPNV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |