C37H58 — CID 159706434
bis((1S,8R)-9-(2-methylpropyl)bicyclo[6.1.0]non-4-yne);3-propan-2-ylcyclooctyne (PubChem CID 159706434) has the molecular formula C37H58 and a molecular weight of 502.87 g/mol. Its IUPAC name is bis((1S,8R)-9-(2-methylpropyl)bicyclo[6.1.0]non-4-yne);3-propan-2-ylcyclooctyne.
| Compound Name | bis((1S,8R)-9-(2-methylpropyl)bicyclo[6.1.0]non-4-yne);3-propan-2-ylcyclooctyne |
|---|---|
| PubChem CID | 159706434 |
| Molecular Formula | C37H58 |
| Molecular Weight | 502.87 g/mol |
| Exact Mass | 502.45 |
| IUPAC Name | bis((1S,8R)-9-(2-methylpropyl)bicyclo[6.1.0]non-4-yne);3-propan-2-ylcyclooctyne |
| SMILES | CC(C)C1C#CCCCCC1.CC(C)CC1[C@H]2CCC#CCC[C@@H]12.CC(C)CC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/2C13H20.C11H18/c2*1-10(2)9-13-11-7-5-3-4-6-8-12(11)13;1-10(2)11-8-6-4-3-5-7-9-11/h2*10-13H,5-9H2,1-2H3;10-11H,3-6,8H2,1-2H3/t2*11-,12+,13?; |
| InChIKey | MYGSWLNKEMNJMG-NZBDJEOASA-N |
| XLogP | 10.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.87 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|