C28H24Cl2N2Na2O6S — CID 15970705
disodium;1-[(6Z)-6-(benzenesulfonylimino)-6-oxidohexyl]-5-[(2,6-dichlorophenyl)methoxy]indole-2-carboxylate (PubChem CID 15970705) has the molecular formula C28H24Cl2N2Na2O6S and a molecular weight of 633.46 g/mol. Its IUPAC name is disodium;1-[(6Z)-6-(benzenesulfonylimino)-6-oxidohexyl]-5-[(2,6-dichlorophenyl)methoxy]indole-2-carboxylate.
| Compound Name | disodium;1-[(6Z)-6-(benzenesulfonylimino)-6-oxidohexyl]-5-[(2,6-dichlorophenyl)methoxy]indole-2-carboxylate |
|---|---|
| PubChem CID | 15970705 |
| Molecular Formula | C28H24Cl2N2Na2O6S |
| Molecular Weight | 633.46 g/mol |
| Exact Mass | 632.05 |
| IUPAC Name | disodium;1-[(6Z)-6-(benzenesulfonylimino)-6-oxidohexyl]-5-[(2,6-dichlorophenyl)methoxy]indole-2-carboxylate |
| SMILES | O=C([O-])c1cc2cc(OCc3c(Cl)cccc3Cl)ccc2n1CCCCC/C([O-])=N/S(=O)(=O)c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C28H26Cl2N2O6S.2Na/c29-23-10-7-11-24(30)22(23)18-38-20-13-14-25-19(16-20)17-26(28(34)35)32(25)15-6-2-5-12-27(33)31-39(36,37)21-8-3-1-4-9-21;;/h1,3-4,7-11,13-14,16-17H,2,5-6,12,15,18H2,(H,31,33)(H,34,35);;/q;2*+1/p-2 |
| InChIKey | WYPDOANOHOAZKN-UHFFFAOYSA-L |
| XLogP | -1.39 |
| TPSA | 123.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.46 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|