C46H26CuN6 — CID 15970709
copper [3-(azanidylidenemethylidene)-5,10,15,20-tetraphenylporphyrin-2-ylidene]methylideneazanide (PubChem CID 15970709) has the molecular formula C46H26CuN6 and a molecular weight of 726.30 g/mol. Its IUPAC name is copper [3-(azanidylidenemethylidene)-5,10,15,20-tetraphenylporphyrin-2-ylidene]methylideneazanide.
| Compound Name | copper [3-(azanidylidenemethylidene)-5,10,15,20-tetraphenylporphyrin-2-ylidene]methylideneazanide |
|---|---|
| PubChem CID | 15970709 |
| Molecular Formula | C46H26CuN6 |
| Molecular Weight | 726.30 g/mol |
| Exact Mass | 725.15 |
| IUPAC Name | copper [3-(azanidylidenemethylidene)-5,10,15,20-tetraphenylporphyrin-2-ylidene]methylideneazanide |
| SMILES | [Cu+2].[N-]=C=C1C(=C=[N-])C2=N/C1=C(/c1ccccc1)C1=N/C(=C(/c3ccccc3)C3=N/C(=C(/c4ccccc4)C4=N\C(=C/2c2ccccc2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C46H26N6.Cu/c47-27-33-34(28-48)46-44(32-19-11-4-12-20-32)40-26-24-38(51-40)42(30-15-7-2-8-16-30)36-22-21-35(49-36)41(29-13-5-1-6-14-29)37-23-25-39(50-37)43(45(33)52-46)31-17-9-3-10-18-31;/h1-26H;/q-2;+2/b41-35-,41-37-,42-36-,42-38-,43-39-,44-40-,45-43-,46-44-; |
| InChIKey | MQCYJEPSMSQDNK-KOYIUONLSA-N |
| XLogP | 9.46 |
| TPSA | 94.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.30 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|