C46H28N6 — CID 15970710
[3-(iminomethylidene)-5,10,15,20-tetraphenylporphyrin-2-ylidene]methanimine (PubChem CID 15970710) has the molecular formula C46H28N6 and a molecular weight of 664.77 g/mol. Its IUPAC name is [3-(iminomethylidene)-5,10,15,20-tetraphenylporphyrin-2-ylidene]methanimine.
| Compound Name | [3-(iminomethylidene)-5,10,15,20-tetraphenylporphyrin-2-ylidene]methanimine |
|---|---|
| PubChem CID | 15970710 |
| Molecular Formula | C46H28N6 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | [3-(iminomethylidene)-5,10,15,20-tetraphenylporphyrin-2-ylidene]methanimine |
| SMILES | N=C=C1C(=C=N)/C2=C(\c3ccccc3)C3=N/C(=C(/c4ccccc4)C4=N/C(=C(/c5ccccc5)C5=N/C(=C(/c6ccccc6)C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C46H28N6/c47-27-33-34(28-48)46-44(32-19-11-4-12-20-32)40-26-24-38(51-40)42(30-15-7-2-8-16-30)36-22-21-35(49-36)41(29-13-5-1-6-14-29)37-23-25-39(50-37)43(45(33)52-46)31-17-9-3-10-18-31/h1-26,47-48H/b41-35-,41-37-,42-36-,42-38-,43-39-,44-40-,45-43-,46-44- |
| InChIKey | ZHBNPUDDNZSSFI-GBWGAWTRSA-N |
| XLogP | 9.48 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|