C17H22O4S3 — CID 159707765
2,4-dimethyl-5-sulfanylphenol;sulfur trioxide;2,4,5-trimethylbenzenethiol (PubChem CID 159707765) has the molecular formula C17H22O4S3 and a molecular weight of 386.56 g/mol. Its IUPAC name is 2,4-dimethyl-5-sulfanylphenol;sulfur trioxide;2,4,5-trimethylbenzenethiol.
| Compound Name | 2,4-dimethyl-5-sulfanylphenol;sulfur trioxide;2,4,5-trimethylbenzenethiol |
|---|---|
| PubChem CID | 159707765 |
| Molecular Formula | C17H22O4S3 |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2,4-dimethyl-5-sulfanylphenol;sulfur trioxide;2,4,5-trimethylbenzenethiol |
| SMILES | Cc1cc(C)c(S)cc1C.Cc1cc(C)c(S)cc1O.O=S(=O)=O |
| InChI | InChI=1S/C9H12S.C8H10OS.O3S/c1-6-4-8(3)9(10)5-7(6)2;1-5-3-6(2)8(10)4-7(5)9;1-4(2)3/h4-5,10H,1-3H3;3-4,9-10H,1-2H3; |
| InChIKey | MYLAQSNJDULMTM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|