C28H54O3Sn — CID 15970807
(1R,2R,3R,4S,5S,6R)-1-[(S)-cyclohexyl(hydroxy)methyl]-2,4-dimethyl-6-tributylstannyl-8-oxabicyclo[3.2.1]octan-3-ol (PubChem CID 15970807) has the molecular formula C28H54O3Sn and a molecular weight of 557.45 g/mol. Its IUPAC name is (1R,2R,3R,4S,5S,6R)-1-[(S)-cyclohexyl(hydroxy)methyl]-2,4-dimethyl-6-tributylstannyl-8-oxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2R,3R,4S,5S,6R)-1-[(S)-cyclohexyl(hydroxy)methyl]-2,4-dimethyl-6-tributylstannyl-8-oxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 15970807 |
| Molecular Formula | C28H54O3Sn |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | (1R,2R,3R,4S,5S,6R)-1-[(S)-cyclohexyl(hydroxy)methyl]-2,4-dimethyl-6-tributylstannyl-8-oxabicyclo[3.2.1]octan-3-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H]1C[C@@]2([C@@H](O)C3CCCCC3)O[C@H]1[C@@H](C)[C@@H](O)[C@H]2C |
| InChI | InChI=1S/C16H27O3.3C4H9.Sn/c1-10-13-8-9-16(19-13,11(2)14(10)17)15(18)12-6-4-3-5-7-12;3*1-3-4-2;/h8,10-15,17-18H,3-7,9H2,1-2H3;3*1,3-4H2,2H3;/t10-,11-,13-,14-,15+,16-;;;;/m1..../s1 |
| InChIKey | WTZMIJPCEYNUDM-IEMQWXCSSA-N |
| XLogP | 7.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |