C37H43ClF4N2O6S — CID 159708079
[5-methylsulfonyl-2-(2,2,3,3-tetrafluoropropoxy)phenyl]-[5-(oxan-4-yl)-1,3-dihydroisoindol-2-yl]methanone;5-(oxan-4-yl)-2,3-dihydro-1H-isoindole;hydrochloride (PubChem CID 159708079) has the molecular formula C37H43ClF4N2O6S and a molecular weight of 755.27 g/mol. Its IUPAC name is [5-methylsulfonyl-2-(2,2,3,3-tetrafluoropropoxy)phenyl]-[5-(oxan-4-yl)-1,3-dihydroisoindol-2-yl]methanone;5-(oxan-4-yl)-2,3-dihydro-1H-isoindole;hydrochloride.
| Compound Name | [5-methylsulfonyl-2-(2,2,3,3-tetrafluoropropoxy)phenyl]-[5-(oxan-4-yl)-1,3-dihydroisoindol-2-yl]methanone;5-(oxan-4-yl)-2,3-dihydro-1H-isoindole;hydrochloride |
|---|---|
| PubChem CID | 159708079 |
| Molecular Formula | C37H43ClF4N2O6S |
| Molecular Weight | 755.27 g/mol |
| Exact Mass | 754.25 |
| IUPAC Name | [5-methylsulfonyl-2-(2,2,3,3-tetrafluoropropoxy)phenyl]-[5-(oxan-4-yl)-1,3-dihydroisoindol-2-yl]methanone;5-(oxan-4-yl)-2,3-dihydro-1H-isoindole;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(OCC(F)(F)C(F)F)c(C(=O)N2Cc3ccc(C4CCOCC4)cc3C2)c1.Cl.c1cc2c(cc1C1CCOCC1)CNC2 |
| InChI | InChI=1S/C24H25F4NO5S.C13H17NO.ClH/c1-35(31,32)19-4-5-21(34-14-24(27,28)23(25)26)20(11-19)22(30)29-12-17-3-2-16(10-18(17)13-29)15-6-8-33-9-7-15;1-2-12-8-14-9-13(12)7-11(1)10-3-5-15-6-4-10;/h2-5,10-11,15,23H,6-9,12-14H2,1H3;1-2,7,10,14H,3-6,8-9H2;1H |
| InChIKey | MYMBCZWNXDQQIU-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.27 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|