C30H33ClNOPPd — CID 15971141
chloropalladium(1+);(1R)-1-(3H-naphthalen-3-id-1-yl)ethanamine;trans-(1S,2S)-2-diphenylphosphanylcyclohexan-1-ol (PubChem CID 15971141) has the molecular formula C30H33ClNOPPd and a molecular weight of 596.45 g/mol. Its IUPAC name is chloropalladium(1+);(1R)-1-(3H-naphthalen-3-id-1-yl)ethanamine;trans-(1S,2S)-2-diphenylphosphanylcyclohexan-1-ol.
| Compound Name | chloropalladium(1+);(1R)-1-(3H-naphthalen-3-id-1-yl)ethanamine;trans-(1S,2S)-2-diphenylphosphanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 15971141 |
| Molecular Formula | C30H33ClNOPPd |
| Molecular Weight | 596.45 g/mol |
| Exact Mass | 595.10 |
| IUPAC Name | chloropalladium(1+);(1R)-1-(3H-naphthalen-3-id-1-yl)ethanamine;trans-(1S,2S)-2-diphenylphosphanylcyclohexan-1-ol |
| SMILES | C[C@@H](N)c1c[c-]cc2ccccc12.Cl[Pd+].O[C@H]1CCCC[C@@H]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21OP.C12H12N.ClH.Pd/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16;1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;;/h1-6,9-12,17-19H,7-8,13-14H2;2-3,5-9H,13H2,1H3;1H;/q;-1;;+2/p-1/t17-,18-;9-;;/m01../s1 |
| InChIKey | KCWHXOFOPQZSSJ-BCABAJGJSA-M |
| XLogP | 6.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.45 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|