C17H26N2O5 — CID 159713200
[4-[2-(ethylamino)-2-oxoethyl]phenyl]methyl 3-(methoxycarbonylamino)propanoate;methane (PubChem CID 159713200) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is [4-[2-(ethylamino)-2-oxoethyl]phenyl]methyl 3-(methoxycarbonylamino)propanoate;methane.
| Compound Name | [4-[2-(ethylamino)-2-oxoethyl]phenyl]methyl 3-(methoxycarbonylamino)propanoate;methane |
|---|---|
| PubChem CID | 159713200 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [4-[2-(ethylamino)-2-oxoethyl]phenyl]methyl 3-(methoxycarbonylamino)propanoate;methane |
| SMILES | C.CCNC(=O)Cc1ccc(COC(=O)CCNC(=O)OC)cc1 |
| InChI | InChI=1S/C16H22N2O5.CH4/c1-3-17-14(19)10-12-4-6-13(7-5-12)11-23-15(20)8-9-18-16(21)22-2;/h4-7H,3,8-11H2,1-2H3,(H,17,19)(H,18,21);1H4 |
| InChIKey | MZCGRAAUXVEEMU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |