C21H15ClFN3O2 — CID 159713207
1-(2-chlorophenyl)-2-[6-fluoro-5-[hydroxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-2-pyridinyl]ethanone (PubChem CID 159713207) has the molecular formula C21H15ClFN3O2 and a molecular weight of 395.82 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-[6-fluoro-5-[hydroxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-2-pyridinyl]ethanone.
| Compound Name | 1-(2-chlorophenyl)-2-[6-fluoro-5-[hydroxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 159713207 |
| Molecular Formula | C21H15ClFN3O2 |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-(2-chlorophenyl)-2-[6-fluoro-5-[hydroxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-2-pyridinyl]ethanone |
| SMILES | O=C(Cc1ccc(C(O)c2c[nH]c3ncccc23)c(F)n1)c1ccccc1Cl |
| InChI | InChI=1S/C21H15ClFN3O2/c22-17-6-2-1-4-14(17)18(27)10-12-7-8-15(20(23)26-12)19(28)16-11-25-21-13(16)5-3-9-24-21/h1-9,11,19,28H,10H2,(H,24,25) |
| InChIKey | JLMZXKFXTYRIKS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|