C15H17N5O — CID 159713443
5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine (PubChem CID 159713443) has the molecular formula C15H17N5O and a molecular weight of 283.34 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine.
| Compound Name | 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine |
|---|---|
| PubChem CID | 159713443 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine |
| SMILES | Cc1nn(-c2ccccc2)c(=O)[nH]1.NNc1ccccc1 |
| InChI | InChI=1S/C9H9N3O.C6H8N2/c1-7-10-9(13)12(11-7)8-5-3-2-4-6-8;7-8-6-4-2-1-3-5-6/h2-6H,1H3,(H,10,11,13);1-5,8H,7H2 |
| InChIKey | MZDBCZFZXQVFTR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|