About 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine
5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine (PubChem CID 159713443) has the molecular formula C15H17N5O
and a molecular weight of 283.34 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine.
Molecular Properties
| Compound Name | 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine |
| PubChem CID | 159713443 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine |
| SMILES | Cc1nn(-c2ccccc2)c(=O)[nH]1.NNc1ccccc1 |
| InChI | InChI=1S/C9H9N3O.C6H8N2/c1-7-10-9(13)12(11-7)8-5-3-2-4-6-8;7-8-6-4-2-1-3-5-6/h2-6H,1H3,(H,10,11,13);1-5,8H,7H2 |
| InChIKey | MZDBCZFZXQVFTR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine?
The IUPAC name of 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine (CID 159713443) is 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine.
What is the SMILES notation for 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine?
The canonical SMILES for 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine is Cc1nn(-c2ccccc2)c(=O)[nH]1.NNc1ccccc1.
What is the InChIKey of 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine?
The InChIKey is MZDBCZFZXQVFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O.C6H8N2/c1-7-10-9(13)12(11-7)8-5-3-2-4-6-8;7-8-6-4-2-1-3-5-6/h2-6H,1H3,(H,10,11,13);1-5,8H,7H2.
What are the key properties of 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine?
5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine has a molecular weight of 283.34 g/mol, XLogP of 1.84, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-phenyl-4H-1,2,4-triazol-3-one;phenylhydrazine is sourced from PubChem (CID 159713443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).