C24H17BrCl2F9NO2 — CID 159715076
4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(2R)-6,6,6-trifluoro-4-oxohexan-2-yl]benzamide (PubChem CID 159715076) has the molecular formula C24H17BrCl2F9NO2 and a molecular weight of 673.20 g/mol. Its IUPAC name is 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(2R)-6,6,6-trifluoro-4-oxohexan-2-yl]benzamide.
| Compound Name | 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(2R)-6,6,6-trifluoro-4-oxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 159715076 |
| Molecular Formula | C24H17BrCl2F9NO2 |
| Molecular Weight | 673.20 g/mol |
| Exact Mass | 670.97 |
| IUPAC Name | 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(2R)-6,6,6-trifluoro-4-oxohexan-2-yl]benzamide |
| SMILES | C[C@H](CC(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Br)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H17BrCl2F9NO2/c1-11(6-14(38)10-22(28,29)30)37-21(39)15-4-2-12(7-17(15)24(34,35)36)3-5-16(23(31,32)33)13-8-18(26)20(25)19(27)9-13/h2-5,7-9,11,16H,6,10H2,1H3,(H,37,39)/b5-3+/t11-,16?/m1/s1 |
| InChIKey | MZIBGAQQDRDELH-GFGJJTIJSA-N |
| XLogP | 9.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.20 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|