C8H10N2OS — CID 159715371
1-(2-amino-4-cyclopropyl-1,3-thiazol-5-yl)ethanone (PubChem CID 159715371) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is 1-(2-amino-4-cyclopropyl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(2-amino-4-cyclopropyl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 159715371 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 1-(2-amino-4-cyclopropyl-1,3-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1sc(N)nc1C1CC1 |
| InChI | InChI=1S/C8H10N2OS/c1-4(11)7-6(5-2-3-5)10-8(9)12-7/h5H,2-3H2,1H3,(H2,9,10) |
| InChIKey | XXPSSZLITWGDAE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |