About 2-ethoxyoxane;ethoxy(trimethyl)silane;methane
2-ethoxyoxane;ethoxy(trimethyl)silane;methane (PubChem CID 159715846) has the molecular formula C13H32O3Si
and a molecular weight of 264.48 g/mol. Its IUPAC name is 2-ethoxyoxane;ethoxy(trimethyl)silane;methane.
Molecular Properties
| Compound Name | 2-ethoxyoxane;ethoxy(trimethyl)silane;methane |
| PubChem CID | 159715846 |
| Molecular Formula | C13H32O3Si |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-ethoxyoxane;ethoxy(trimethyl)silane;methane |
| SMILES | C.CCOC1CCCCO1.CCO[Si](C)(C)C |
| InChI | InChI=1S/C7H14O2.C5H14OSi.CH4/c1-2-8-7-5-3-4-6-9-7;1-5-6-7(2,3)4;/h7H,2-6H2,1H3;5H2,1-4H3;1H4 |
| InChIKey | MZKMRPNTEWVGCN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyoxane;ethoxy(trimethyl)silane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyoxane;ethoxy(trimethyl)silane;methane?
The IUPAC name of 2-ethoxyoxane;ethoxy(trimethyl)silane;methane (CID 159715846) is 2-ethoxyoxane;ethoxy(trimethyl)silane;methane.
What is the SMILES notation for 2-ethoxyoxane;ethoxy(trimethyl)silane;methane?
The canonical SMILES for 2-ethoxyoxane;ethoxy(trimethyl)silane;methane is C.CCOC1CCCCO1.CCO[Si](C)(C)C.
What is the InChIKey of 2-ethoxyoxane;ethoxy(trimethyl)silane;methane?
The InChIKey is MZKMRPNTEWVGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C5H14OSi.CH4/c1-2-8-7-5-3-4-6-9-7;1-5-6-7(2,3)4;/h7H,2-6H2,1H3;5H2,1-4H3;1H4.
What are the key properties of 2-ethoxyoxane;ethoxy(trimethyl)silane;methane?
2-ethoxyoxane;ethoxy(trimethyl)silane;methane has a molecular weight of 264.48 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyoxane;ethoxy(trimethyl)silane;methane is sourced from PubChem (CID 159715846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).