C18H19ClFN2O7P — CID 159719090
5-chloro-1-[(2R,3R,5R)-2-deuterio-5-[dideuterio-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3-hydroxyoxolan-2-yl]-2-methylidenepyrimidin-4-one (PubChem CID 159719090) has the molecular formula C18H19ClFN2O7P and a molecular weight of 463.80 g/mol. Its IUPAC name is 5-chloro-1-[(2R,3R,5R)-2-deuterio-5-[dideuterio-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3-hydroxyoxolan-2-yl]-2-methylidenepyrimidin-4-one.
| Compound Name | 5-chloro-1-[(2R,3R,5R)-2-deuterio-5-[dideuterio-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3-hydroxyoxolan-2-yl]-2-methylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 159719090 |
| Molecular Formula | C18H19ClFN2O7P |
| Molecular Weight | 463.80 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 5-chloro-1-[(2R,3R,5R)-2-deuterio-5-[dideuterio-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3-hydroxyoxolan-2-yl]-2-methylidenepyrimidin-4-one |
| SMILES | [2H]C([2H])(OP1(=O)OCc2cccc(C)c2O1)[C@]1(F)C[C@@H](O)[C@]([2H])(N2C=C(Cl)C(=O)NC2=C)O1 |
| InChI | InChI=1S/C18H19ClFN2O7P/c1-10-4-3-5-12-8-26-30(25,29-15(10)12)27-9-18(20)6-14(23)17(28-18)22-7-13(19)16(24)21-11(22)2/h3-5,7,14,17,23H,2,6,8-9H2,1H3,(H,21,24)/t14-,17-,18+,30?/m1/s1/i9D2,17D |
| InChIKey | HNHHHNPDXQGHOZ-LPCNDBITSA-N |
| XLogP | 2.79 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|