About (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium
(7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium (PubChem CID 159719114) has the molecular formula C8H21N3OY+2
and a molecular weight of 264.18 g/mol. Its IUPAC name is (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium.
Molecular Properties
| Compound Name | (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium |
| PubChem CID | 159719114 |
| Molecular Formula | C8H21N3OY+2 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium |
| SMILES | C.CC(=O)C([NH3+])CCCC(N)=[NH2+].[Y] |
| InChI | InChI=1S/C7H15N3O.CH4.Y/c1-5(11)6(8)3-2-4-7(9)10;;/h6H,2-4,8H2,1H3,(H3,9,10);1H4;/p+2 |
| InChIKey | KTUQXTGGTQPNBD-UHFFFAOYSA-P |
| XLogP | -1.89 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium?
The IUPAC name of (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium (CID 159719114) is (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium.
What is the SMILES notation for (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium?
The canonical SMILES for (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium is C.CC(=O)C([NH3+])CCCC(N)=[NH2+].[Y].
What is the InChIKey of (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium?
The InChIKey is KTUQXTGGTQPNBD-UHFFFAOYSA-P. The full InChI is InChI=1S/C7H15N3O.CH4.Y/c1-5(11)6(8)3-2-4-7(9)10;;/h6H,2-4,8H2,1H3,(H3,9,10);1H4;/p+2.
What are the key properties of (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium?
(7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium has a molecular weight of 264.18 g/mol, XLogP of -1.89, 5 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7-amino-7-azaniumylidene-2-oxoheptan-3-yl)azanium;methane;yttrium is sourced from PubChem (CID 159719114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).