C9H10O4 — CID 15972045
(1S,3R,4S,7R,9S,12R)-6,8,10-trioxatetracyclo[7.3.0.03,7.04,12]dodecan-2-one (PubChem CID 15972045) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is (1S,3R,4S,7R,9S,12R)-6,8,10-trioxatetracyclo[7.3.0.03,7.04,12]dodecan-2-one.
| Compound Name | (1S,3R,4S,7R,9S,12R)-6,8,10-trioxatetracyclo[7.3.0.03,7.04,12]dodecan-2-one |
|---|---|
| PubChem CID | 15972045 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (1S,3R,4S,7R,9S,12R)-6,8,10-trioxatetracyclo[7.3.0.03,7.04,12]dodecan-2-one |
| SMILES | O=C1[C@@H]2[C@H]3OC[C@@H]2[C@@H]2CO[C@H](O3)[C@H]12 |
| InChI | InChI=1S/C9H10O4/c10-7-5-3-1-11-8(5)13-9-6(7)4(3)2-12-9/h3-6,8-9H,1-2H2/t3-,4+,5-,6+,8+,9- |
| InChIKey | LFKONQGXXLWTJU-JWPNPCIKSA-N |
| XLogP | -0.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |