C44H24N6S2 — CID 159720479
2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]-4-(2-isocyanophenyl)-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 159720479) has the molecular formula C44H24N6S2 and a molecular weight of 700.85 g/mol. Its IUPAC name is 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]-4-(2-isocyanophenyl)-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]-4-(2-isocyanophenyl)-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 159720479 |
| Molecular Formula | C44H24N6S2 |
| Molecular Weight | 700.85 g/mol |
| Exact Mass | 700.15 |
| IUPAC Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]-4-(2-isocyanophenyl)-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | [C-]#[N+]c1ccccc1-c1nc(-c2ccc3sc4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4c3c2)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C44H24N6S2/c1-45-33-20-10-8-17-29(33)38-40-39(30-18-9-11-21-34(30)52-40)47-43(46-38)28-23-24-35-32(25-28)37-31(19-12-22-36(37)51-35)44-49-41(26-13-4-2-5-14-26)48-42(50-44)27-15-6-3-7-16-27/h2-25H |
| InChIKey | RIZKFJMBRABRBZ-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 68.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.85 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|