C26H30N6O2S2 — CID 159721242
2,2-dimethyl-N-(5-pyridin-4-yl-1,3-thiazol-2-yl)propanamide (PubChem CID 159721242) has the molecular formula C26H30N6O2S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is 2,2-dimethyl-N-(5-pyridin-4-yl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 2,2-dimethyl-N-(5-pyridin-4-yl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 159721242 |
| Molecular Formula | C26H30N6O2S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2,2-dimethyl-N-(5-pyridin-4-yl-1,3-thiazol-2-yl)propanamide |
| SMILES | CC(C)(C)C(=O)Nc1ncc(-c2ccncc2)s1.CC(C)(C)C(=O)Nc1ncc(-c2ccncc2)s1 |
| InChI | InChI=1S/2C13H15N3OS/c2*1-13(2,3)11(17)16-12-15-8-10(18-12)9-4-6-14-7-5-9/h2*4-8H,1-3H3,(H,15,16,17) |
| InChIKey | NABGXMXOKYIYAG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |