About N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide
N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide (PubChem CID 159721978) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide |
| PubChem CID | 159721978 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCN(C)C.C=CC(N)=O |
| InChI | InChI=1S/C9H18N2O.C3H5NO/c1-8(2)9(12)10-6-5-7-11(3)4;1-2-3(4)5/h1,5-7H2,2-4H3,(H,10,12);2H,1H2,(H2,4,5) |
| InChIKey | NADPRMWVOOYJEX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide?
The IUPAC name of N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide (CID 159721978) is N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide.
What is the SMILES notation for N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide?
The canonical SMILES for N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide is C=C(C)C(=O)NCCCN(C)C.C=CC(N)=O.
What is the InChIKey of N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide?
The InChIKey is NADPRMWVOOYJEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C3H5NO/c1-8(2)9(12)10-6-5-7-11(3)4;1-2-3(4)5/h1,5-7H2,2-4H3,(H,10,12);2H,1H2,(H2,4,5).
What are the key properties of N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide?
N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide has a molecular weight of 241.33 g/mol, XLogP of 0.29, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-2-enamide is sourced from PubChem (CID 159721978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).