C19H18ClNS2 — CID 159722499
(3S)-8-chloro-3-(2-methylsulfanylethyl)-1-phenyl-3,5-dihydro-2-benzazepine-4-thione (PubChem CID 159722499) has the molecular formula C19H18ClNS2 and a molecular weight of 359.95 g/mol. Its IUPAC name is (3S)-8-chloro-3-(2-methylsulfanylethyl)-1-phenyl-3,5-dihydro-2-benzazepine-4-thione.
| Compound Name | (3S)-8-chloro-3-(2-methylsulfanylethyl)-1-phenyl-3,5-dihydro-2-benzazepine-4-thione |
|---|---|
| PubChem CID | 159722499 |
| Molecular Formula | C19H18ClNS2 |
| Molecular Weight | 359.95 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (3S)-8-chloro-3-(2-methylsulfanylethyl)-1-phenyl-3,5-dihydro-2-benzazepine-4-thione |
| SMILES | CSCC[C@@H]1N=C(c2ccccc2)c2cc(Cl)ccc2CC1=S |
| InChI | InChI=1S/C19H18ClNS2/c1-23-10-9-17-18(22)11-14-7-8-15(20)12-16(14)19(21-17)13-5-3-2-4-6-13/h2-8,12,17H,9-11H2,1H3/t17-/m0/s1 |
| InChIKey | NAFGBBJGFYSORL-KRWDZBQOSA-N |
| XLogP | 5.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.95 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|