C11H20N2OW — CID 159722767
3,5-di(propan-2-yl)pyrimidin-4-one;methane;tungsten (PubChem CID 159722767) has the molecular formula C11H20N2OW and a molecular weight of 380.13 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)pyrimidin-4-one;methane;tungsten.
| Compound Name | 3,5-di(propan-2-yl)pyrimidin-4-one;methane;tungsten |
|---|---|
| PubChem CID | 159722767 |
| Molecular Formula | C11H20N2OW |
| Molecular Weight | 380.13 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3,5-di(propan-2-yl)pyrimidin-4-one;methane;tungsten |
| SMILES | C.CC(C)c1cncn(C(C)C)c1=O.[W] |
| InChI | InChI=1S/C10H16N2O.CH4.W/c1-7(2)9-5-11-6-12(8(3)4)10(9)13;;/h5-8H,1-4H3;1H4; |
| InChIKey | NAGBGFVYIBVAFF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.13 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |