C22H30N2O2 — CID 159723682
2,3,4,5-tetramethyl-6-methyliminocyclohexa-2,4-dien-1-one;2,3,5,6-tetramethyl-4-methyliminocyclohexa-2,5-dien-1-one (PubChem CID 159723682) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-6-methyliminocyclohexa-2,4-dien-1-one;2,3,5,6-tetramethyl-4-methyliminocyclohexa-2,5-dien-1-one.
| Compound Name | 2,3,4,5-tetramethyl-6-methyliminocyclohexa-2,4-dien-1-one;2,3,5,6-tetramethyl-4-methyliminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 159723682 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2,3,4,5-tetramethyl-6-methyliminocyclohexa-2,4-dien-1-one;2,3,5,6-tetramethyl-4-methyliminocyclohexa-2,5-dien-1-one |
| SMILES | C/N=C1\C(=O)C(C)=C(C)C(C)=C1C.CN=C1C(C)=C(C)C(=O)C(C)=C1C |
| InChI | InChI=1S/2C11H15NO/c1-6-8(3)11(13)9(4)7(2)10(6)12-5;1-6-7(2)9(4)11(13)10(12-5)8(6)3/h2*1-5H3/b;12-10- |
| InChIKey | NAJBQWABQJUPPJ-MJVSHCNMSA-N |
| XLogP | 4.63 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'} |
|---|