C23H33N3O3S — CID 159724602
2-(3-aminophenyl)sulfonyl-1-[3-tert-butyl-1-(1-cyclohexylethyl)pyrazol-5-yl]ethanone (PubChem CID 159724602) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfonyl-1-[3-tert-butyl-1-(1-cyclohexylethyl)pyrazol-5-yl]ethanone.
| Compound Name | 2-(3-aminophenyl)sulfonyl-1-[3-tert-butyl-1-(1-cyclohexylethyl)pyrazol-5-yl]ethanone |
|---|---|
| PubChem CID | 159724602 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-(3-aminophenyl)sulfonyl-1-[3-tert-butyl-1-(1-cyclohexylethyl)pyrazol-5-yl]ethanone |
| SMILES | CC(C1CCCCC1)n1nc(C(C)(C)C)cc1C(=O)CS(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C23H33N3O3S/c1-16(17-9-6-5-7-10-17)26-20(14-22(25-26)23(2,3)4)21(27)15-30(28,29)19-12-8-11-18(24)13-19/h8,11-14,16-17H,5-7,9-10,15,24H2,1-4H3 |
| InChIKey | NALYZNHZZULTQB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|