About methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline
methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline (PubChem CID 159724711) has the molecular formula C25H21N5S
and a molecular weight of 423.55 g/mol. Its IUPAC name is methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline.
Molecular Properties
| Compound Name | methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline |
| PubChem CID | 159724711 |
| Molecular Formula | C25H21N5S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline |
| SMILES | Cc1cccc(-c2nn(-c3ccccc3)cc2-c2ccnc3ccccc23)n1.NC=S |
| InChI | InChI=1S/C24H18N4.CH3NS/c1-17-8-7-13-23(26-17)24-21(16-28(27-24)18-9-3-2-4-10-18)19-14-15-25-22-12-6-5-11-20(19)22;2-1-3/h2-16H,1H3;1H,(H2,2,3) |
| InChIKey | NAMHLSFDQFXTLV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline?
The IUPAC name of methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline (CID 159724711) is methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline.
What is the SMILES notation for methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline?
The canonical SMILES for methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline is Cc1cccc(-c2nn(-c3ccccc3)cc2-c2ccnc3ccccc23)n1.NC=S.
What is the InChIKey of methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline?
The InChIKey is NAMHLSFDQFXTLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N4.CH3NS/c1-17-8-7-13-23(26-17)24-21(16-28(27-24)18-9-3-2-4-10-18)19-14-15-25-22-12-6-5-11-20(19)22;2-1-3/h2-16H,1H3;1H,(H2,2,3).
What are the key properties of methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline?
methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline has a molecular weight of 423.55 g/mol, XLogP of 5.36, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanethioamide;4-[3-(6-methyl-2-pyridinyl)-1-phenylpyrazol-4-yl]quinoline is sourced from PubChem (CID 159724711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).