C30H32N4O2Zn — CID 15972547
zinc 3-[18-(3-hydroxypropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propan-1-ol (PubChem CID 15972547) has the molecular formula C30H32N4O2Zn and a molecular weight of 546.00 g/mol. Its IUPAC name is zinc 3-[18-(3-hydroxypropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propan-1-ol.
| Compound Name | zinc 3-[18-(3-hydroxypropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 15972547 |
| Molecular Formula | C30H32N4O2Zn |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | zinc 3-[18-(3-hydroxypropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propan-1-ol |
| SMILES | CC1=Cc2cc3[n-]c(cc4[n-]c(cc5nc(cc1n2)C=C5C)c(C)c4CCCO)c(CCCO)c3C.[Zn+2] |
| InChI | InChI=1S/C30H32N4O2.Zn/c1-17-11-22-14-27-19(3)23(7-5-9-35)29(33-27)16-30-24(8-6-10-36)20(4)28(34-30)15-26-18(2)12-21(32-26)13-25(17)31-22;/h11-16,35-36H,5-10H2,1-4H3;/q-2;+2/b21-13-,22-14-,25-13-,26-15-,27-14-,28-15-,29-16-,30-16-; |
| InChIKey | RRKMDDMMEBGPQF-UQNLBECZSA-N |
| XLogP | 5.16 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|