About carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine
carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine (PubChem CID 159725601) has the molecular formula C9H9F3N2O2
and a molecular weight of 234.18 g/mol. Its IUPAC name is carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine |
| PubChem CID | 159725601 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine |
| SMILES | CCCc1cnc(C(F)(F)F)nc1.O=C=O |
| InChI | InChI=1S/C8H9F3N2.CO2/c1-2-3-6-4-12-7(13-5-6)8(9,10)11;2-1-3/h4-5H,2-3H2,1H3; |
| InChIKey | NAOZURUTAPBDGC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine?
The IUPAC name of carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine (CID 159725601) is carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine.
What is the SMILES notation for carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine?
The canonical SMILES for carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine is CCCc1cnc(C(F)(F)F)nc1.O=C=O.
What is the InChIKey of carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine?
The InChIKey is NAOZURUTAPBDGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2.CO2/c1-2-3-6-4-12-7(13-5-6)8(9,10)11;2-1-3/h4-5H,2-3H2,1H3;.
What are the key properties of carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine?
carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine has a molecular weight of 234.18 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;5-propyl-2-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 159725601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).