C15H23NO — CID 159725821
5,6-ditert-butyl-2,3-dihydrofuro[3,2-b]pyridine (PubChem CID 159725821) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 5,6-ditert-butyl-2,3-dihydrofuro[3,2-b]pyridine.
| Compound Name | 5,6-ditert-butyl-2,3-dihydrofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 159725821 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 5,6-ditert-butyl-2,3-dihydrofuro[3,2-b]pyridine |
| SMILES | CC(C)(C)c1cc2c(nc1C(C)(C)C)CCO2 |
| InChI | InChI=1S/C15H23NO/c1-14(2,3)10-9-12-11(7-8-17-12)16-13(10)15(4,5)6/h9H,7-8H2,1-6H3 |
| InChIKey | QGWAVOKJXNOYGY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |