C25H37F17NO+ — CID 159725912
tributyl(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecoxymethyl)azanium (PubChem CID 159725912) has the molecular formula C25H37F17NO+ and a molecular weight of 690.54 g/mol. Its IUPAC name is tributyl(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecoxymethyl)azanium.
| Compound Name | tributyl(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecoxymethyl)azanium |
|---|---|
| PubChem CID | 159725912 |
| Molecular Formula | C25H37F17NO+ |
| Molecular Weight | 690.54 g/mol |
| Exact Mass | 690.26 |
| IUPAC Name | tributyl(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecoxymethyl)azanium |
| SMILES | CCCC[N+](CCCC)(CCCC)COCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H37F17NO/c1-4-7-13-43(14-8-5-2,15-9-6-3)17-44-16-11-10-12-18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)24(38,39)25(40,41)42/h4-17H2,1-3H3/q+1 |
| InChIKey | APJDLLINHFLLLH-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.54 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|