C23H26OS4 — CID 159726096
1,7-dihydro-2,6-benzodithionin-4-one;4-methylidene-1,7-dihydro-2,6-benzodithionine (PubChem CID 159726096) has the molecular formula C23H26OS4 and a molecular weight of 446.73 g/mol. Its IUPAC name is 1,7-dihydro-2,6-benzodithionin-4-one;4-methylidene-1,7-dihydro-2,6-benzodithionine.
| Compound Name | 1,7-dihydro-2,6-benzodithionin-4-one;4-methylidene-1,7-dihydro-2,6-benzodithionine |
|---|---|
| PubChem CID | 159726096 |
| Molecular Formula | C23H26OS4 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1,7-dihydro-2,6-benzodithionin-4-one;4-methylidene-1,7-dihydro-2,6-benzodithionine |
| SMILES | C=C1CSCc2ccccc2CSC1.O=C1CSCc2ccccc2CSC1 |
| InChI | InChI=1S/C12H14S2.C11H12OS2/c1-10-6-13-8-11-4-2-3-5-12(11)9-14-7-10;12-11-7-13-5-9-3-1-2-4-10(9)6-14-8-11/h2-5H,1,6-9H2;1-4H,5-8H2 |
| InChIKey | NAQQGWGWUNRZPI-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|