About 2-benzothiophen-1-amine;methyl formate
2-benzothiophen-1-amine;methyl formate (PubChem CID 159726940) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-benzothiophen-1-amine;methyl formate.
Molecular Properties
| Compound Name | 2-benzothiophen-1-amine;methyl formate |
| PubChem CID | 159726940 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-benzothiophen-1-amine;methyl formate |
| SMILES | COC=O.Nc1scc2ccccc12 |
| InChI | InChI=1S/C8H7NS.C2H4O2/c9-8-7-4-2-1-3-6(7)5-10-8;1-4-2-3/h1-5H,9H2;2H,1H3 |
| InChIKey | NATGVLJZXTUWHW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-benzothiophen-1-amine;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzothiophen-1-amine;methyl formate?
The IUPAC name of 2-benzothiophen-1-amine;methyl formate (CID 159726940) is 2-benzothiophen-1-amine;methyl formate.
What is the SMILES notation for 2-benzothiophen-1-amine;methyl formate?
The canonical SMILES for 2-benzothiophen-1-amine;methyl formate is COC=O.Nc1scc2ccccc12.
What is the InChIKey of 2-benzothiophen-1-amine;methyl formate?
The InChIKey is NATGVLJZXTUWHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.C2H4O2/c9-8-7-4-2-1-3-6(7)5-10-8;1-4-2-3/h1-5H,9H2;2H,1H3.
What are the key properties of 2-benzothiophen-1-amine;methyl formate?
2-benzothiophen-1-amine;methyl formate has a molecular weight of 209.27 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzothiophen-1-amine;methyl formate is sourced from PubChem (CID 159726940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).