C26H33F3N2O6 — CID 159727137
(E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-12-methoxy-15-(trifluoromethyl)-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-trien-4-yl]-1-hydroxy-4-methoxybut-3-en-2-one (PubChem CID 159727137) has the molecular formula C26H33F3N2O6 and a molecular weight of 526.55 g/mol. Its IUPAC name is (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-12-methoxy-15-(trifluoromethyl)-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-trien-4-yl]-1-hydroxy-4-methoxybut-3-en-2-one.
| Compound Name | (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-12-methoxy-15-(trifluoromethyl)-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-trien-4-yl]-1-hydroxy-4-methoxybut-3-en-2-one |
|---|---|
| PubChem CID | 159727137 |
| Molecular Formula | C26H33F3N2O6 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-12-methoxy-15-(trifluoromethyl)-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-trien-4-yl]-1-hydroxy-4-methoxybut-3-en-2-one |
| SMILES | CC[C@@H]1CN2CC[C@@]34OCCO[C@@]3(Nc3c(C(F)(F)F)ccc(OC)c34)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)CO |
| InChI | InChI=1S/C26H33F3N2O6/c1-4-15-12-31-8-7-24-22-20(35-3)6-5-18(26(27,28)29)23(22)30-25(24,37-10-9-36-24)21(31)11-16(15)17(14-34-2)19(33)13-32/h5-6,14-16,21,30,32H,4,7-13H2,1-3H3/b17-14+/t15-,16+,21+,24+,25+/m1/s1 |
| InChIKey | CFJUSUFIKLMVFB-VXVVBAGYSA-N |
| XLogP | 3.29 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|